C11H18N2O3 — CID 43446819
5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentanoic acid (PubChem CID 43446819) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentanoic acid.
| Compound Name | 5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentanoic acid |
|---|---|
| PubChem CID | 43446819 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 5-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pentanoic acid |
| SMILES | CC(C)(C)c1noc(CCCCC(=O)O)n1 |
| InChI | InChI=1S/C11H18N2O3/c1-11(2,3)10-12-8(16-13-10)6-4-5-7-9(14)15/h4-7H2,1-3H3,(H,14,15) |
| InChIKey | PMWKKHWKMNTKMW-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|