C13H10F3N3O — CID 43448405
3-amino-4-(2,3,4-trifluoroanilino)benzamide (PubChem CID 43448405) has the molecular formula C13H10F3N3O and a molecular weight of 281.24 g/mol. Its IUPAC name is 3-amino-4-(2,3,4-trifluoroanilino)benzamide.
| Compound Name | 3-amino-4-(2,3,4-trifluoroanilino)benzamide |
|---|---|
| PubChem CID | 43448405 |
| Molecular Formula | C13H10F3N3O |
| Molecular Weight | 281.24 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 3-amino-4-(2,3,4-trifluoroanilino)benzamide |
| SMILES | NC(=O)c1ccc(Nc2ccc(F)c(F)c2F)c(N)c1 |
| InChI | InChI=1S/C13H10F3N3O/c14-7-2-4-10(12(16)11(7)15)19-9-3-1-6(13(18)20)5-8(9)17/h1-5,19H,17H2,(H2,18,20) |
| InChIKey | CMQYPKNRJQIBCE-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.24 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|