C14H24N4O2S — CID 43449093
3-amino-N-methyl-4-(4-propylpiperazin-1-yl)benzenesulfonamide (PubChem CID 43449093) has the molecular formula C14H24N4O2S and a molecular weight of 312.44 g/mol. Its IUPAC name is 3-amino-N-methyl-4-(4-propylpiperazin-1-yl)benzenesulfonamide.
| Compound Name | 3-amino-N-methyl-4-(4-propylpiperazin-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 43449093 |
| Molecular Formula | C14H24N4O2S |
| Molecular Weight | 312.44 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 3-amino-N-methyl-4-(4-propylpiperazin-1-yl)benzenesulfonamide |
| SMILES | CCCN1CCN(c2ccc(S(=O)(=O)NC)cc2N)CC1 |
| InChI | InChI=1S/C14H24N4O2S/c1-3-6-17-7-9-18(10-8-17)14-5-4-12(11-13(14)15)21(19,20)16-2/h4-5,11,16H,3,6-10,15H2,1-2H3 |
| InChIKey | IAEVRQVKGHHGCM-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.44 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|