C17H15ClN2O — CID 43449591
5-(4-chloro-2,6-dimethylphenoxy)quinolin-8-amine (PubChem CID 43449591) has the molecular formula C17H15ClN2O and a molecular weight of 298.77 g/mol. Its IUPAC name is 5-(4-chloro-2,6-dimethylphenoxy)quinolin-8-amine.
| Compound Name | 5-(4-chloro-2,6-dimethylphenoxy)quinolin-8-amine |
|---|---|
| PubChem CID | 43449591 |
| Molecular Formula | C17H15ClN2O |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 5-(4-chloro-2,6-dimethylphenoxy)quinolin-8-amine |
| SMILES | Cc1cc(Cl)cc(C)c1Oc1ccc(N)c2ncccc12 |
| InChI | InChI=1S/C17H15ClN2O/c1-10-8-12(18)9-11(2)17(10)21-15-6-5-14(19)16-13(15)4-3-7-20-16/h3-9H,19H2,1-2H3 |
| InChIKey | QZWPFJLCVBKACV-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|