C18H19N3 — CID 43450085
8-N-methyl-8-N-[(4-methylphenyl)methyl]quinoline-5,8-diamine (PubChem CID 43450085) has the molecular formula C18H19N3 and a molecular weight of 277.37 g/mol. Its IUPAC name is 8-N-methyl-8-N-[(4-methylphenyl)methyl]quinoline-5,8-diamine.
| Compound Name | 8-N-methyl-8-N-[(4-methylphenyl)methyl]quinoline-5,8-diamine |
|---|---|
| PubChem CID | 43450085 |
| Molecular Formula | C18H19N3 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 8-N-methyl-8-N-[(4-methylphenyl)methyl]quinoline-5,8-diamine |
| SMILES | Cc1ccc(CN(C)c2ccc(N)c3cccnc23)cc1 |
| InChI | InChI=1S/C18H19N3/c1-13-5-7-14(8-6-13)12-21(2)17-10-9-16(19)15-4-3-11-20-18(15)17/h3-11H,12,19H2,1-2H3 |
| InChIKey | VDVDOOQLHBRKHV-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|