C14H20N2O4 — CID 43452003
methyl 2-[(3-amino-4-methoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 43452003) has the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. Its IUPAC name is methyl 2-[(3-amino-4-methoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | methyl 2-[(3-amino-4-methoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 43452003 |
| Molecular Formula | C14H20N2O4 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.14 |
| IUPAC Name | methyl 2-[(3-amino-4-methoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | COC(=O)C(NC(=O)c1ccc(OC)c(N)c1)C(C)C |
| InChI | InChI=1S/C14H20N2O4/c1-8(2)12(14(18)20-4)16-13(17)9-5-6-11(19-3)10(15)7-9/h5-8,12H,15H2,1-4H3,(H,16,17) |
| InChIKey | UHNYZXRRUWLEBJ-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|