C14H9Cl2NO3 — CID 43452757
3-[(3,5-dichlorophenyl)carbamoyl]benzoic acid (PubChem CID 43452757) has the molecular formula C14H9Cl2NO3 and a molecular weight of 310.14 g/mol. Its IUPAC name is 3-[(3,5-dichlorophenyl)carbamoyl]benzoic acid.
| Compound Name | 3-[(3,5-dichlorophenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 43452757 |
| Molecular Formula | C14H9Cl2NO3 |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.00 |
| IUPAC Name | 3-[(3,5-dichlorophenyl)carbamoyl]benzoic acid |
| SMILES | O=C(O)c1cccc(C(=O)Nc2cc(Cl)cc(Cl)c2)c1 |
| InChI | InChI=1S/C14H9Cl2NO3/c15-10-5-11(16)7-12(6-10)17-13(18)8-2-1-3-9(4-8)14(19)20/h1-7H,(H,17,18)(H,19,20) |
| InChIKey | WSGSTUOWBDSICL-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |