About 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole
2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole (PubChem CID 43455760) has the molecular formula C10H15ClN2O2S2
and a molecular weight of 294.83 g/mol. Its IUPAC name is 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole.
Molecular Properties
| Compound Name | 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole |
| PubChem CID | 43455760 |
| Molecular Formula | C10H15ClN2O2S2 |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole |
| SMILES | CC1CCCC(C)N1S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H15ClN2O2S2/c1-7-4-3-5-8(2)13(7)17(14,15)9-6-12-10(11)16-9/h6-8H,3-5H2,1-2H3 |
| InChIKey | PQKBHXGONADJKV-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole?
The IUPAC name of 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole (CID 43455760) is 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole.
What is the SMILES notation for 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole?
The canonical SMILES for 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole is CC1CCCC(C)N1S(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole?
The InChIKey is PQKBHXGONADJKV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClN2O2S2/c1-7-4-3-5-8(2)13(7)17(14,15)9-6-12-10(11)16-9/h6-8H,3-5H2,1-2H3.
What are the key properties of 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole?
2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole has a molecular weight of 294.83 g/mol, XLogP of 2.75, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(2,6-dimethylpiperidin-1-yl)sulfonyl-1,3-thiazole is sourced from PubChem (CID 43455760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).