About 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide
2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide (PubChem CID 43455773) has the molecular formula C6H9ClN2O2S2
and a molecular weight of 240.74 g/mol. Its IUPAC name is 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 43455773 |
| Molecular Formula | C6H9ClN2O2S2 |
| Molecular Weight | 240.74 g/mol |
| Exact Mass | 239.98 |
| IUPAC Name | 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide |
| SMILES | CC(C)NS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H9ClN2O2S2/c1-4(2)9-13(10,11)5-3-8-6(7)12-5/h3-4,9H,1-2H3 |
| InChIKey | SRVJRLFJDDOLQF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.74 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide (CID 43455773) is 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide is CC(C)NS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide?
The InChIKey is SRVJRLFJDDOLQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClN2O2S2/c1-4(2)9-13(10,11)5-3-8-6(7)12-5/h3-4,9H,1-2H3.
What are the key properties of 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide?
2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide has a molecular weight of 240.74 g/mol, XLogP of 1.48, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-propan-2-yl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 43455773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).