About N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide
N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide (PubChem CID 43455776) has the molecular formula C7H11ClN2O2S2
and a molecular weight of 254.76 g/mol. Its IUPAC name is N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide |
| PubChem CID | 43455776 |
| Molecular Formula | C7H11ClN2O2S2 |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.00 |
| IUPAC Name | N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(C)NS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H11ClN2O2S2/c1-3-5(2)10-14(11,12)6-4-9-7(8)13-6/h4-5,10H,3H2,1-2H3 |
| InChIKey | RSQHPHOPCBVLTC-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide?
The IUPAC name of N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide (CID 43455776) is N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide?
The canonical SMILES for N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide is CCC(C)NS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide?
The InChIKey is RSQHPHOPCBVLTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11ClN2O2S2/c1-3-5(2)10-14(11,12)6-4-9-7(8)13-6/h4-5,10H,3H2,1-2H3.
What are the key properties of N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide?
N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide has a molecular weight of 254.76 g/mol, XLogP of 1.87, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-yl-2-chloro-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 43455776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).