About 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide
2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide (PubChem CID 43455780) has the molecular formula C8H13ClN2O2S2
and a molecular weight of 268.79 g/mol. Its IUPAC name is 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide |
| PubChem CID | 43455780 |
| Molecular Formula | C8H13ClN2O2S2 |
| Molecular Weight | 268.79 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide |
| SMILES | CCC(CC)NS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C8H13ClN2O2S2/c1-3-6(4-2)11-15(12,13)7-5-10-8(9)14-7/h5-6,11H,3-4H2,1-2H3 |
| InChIKey | ZNUDOTCXAVUADA-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.79 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide (CID 43455780) is 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide is CCC(CC)NS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide?
The InChIKey is ZNUDOTCXAVUADA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13ClN2O2S2/c1-3-6(4-2)11-15(12,13)7-5-10-8(9)14-7/h5-6,11H,3-4H2,1-2H3.
What are the key properties of 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide?
2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide has a molecular weight of 268.79 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-pentan-3-yl-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 43455780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).