About 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol
1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol (PubChem CID 43455819) has the molecular formula C8H11ClN2O3S2
and a molecular weight of 282.77 g/mol. Its IUPAC name is 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol.
Molecular Properties
| Compound Name | 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol |
| PubChem CID | 43455819 |
| Molecular Formula | C8H11ClN2O3S2 |
| Molecular Weight | 282.77 g/mol |
| Exact Mass | 281.99 |
| IUPAC Name | 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol |
| SMILES | O=S(=O)(c1cnc(Cl)s1)N1CCC(O)CC1 |
| InChI | InChI=1S/C8H11ClN2O3S2/c9-8-10-5-7(15-8)16(13,14)11-3-1-6(12)2-4-11/h5-6,12H,1-4H2 |
| InChIKey | ZMTYRBQUPZTXAQ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.77 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol?
The IUPAC name of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol (CID 43455819) is 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol.
What is the SMILES notation for 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol?
The canonical SMILES for 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol is O=S(=O)(c1cnc(Cl)s1)N1CCC(O)CC1.
What is the InChIKey of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol?
The InChIKey is ZMTYRBQUPZTXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11ClN2O3S2/c9-8-10-5-7(15-8)16(13,14)11-3-1-6(12)2-4-11/h5-6,12H,1-4H2.
What are the key properties of 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol?
1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol has a molecular weight of 282.77 g/mol, XLogP of 0.94, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2-chloro-1,3-thiazol-5-yl)sulfonyl]piperidin-4-ol is sourced from PubChem (CID 43455819), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).