About 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide
2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide (PubChem CID 43455856) has the molecular formula C10H18ClN3O2S2
and a molecular weight of 311.86 g/mol. Its IUPAC name is 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide |
| PubChem CID | 43455856 |
| Molecular Formula | C10H18ClN3O2S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide |
| SMILES | CN(C)CC(C)(C)CNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C10H18ClN3O2S2/c1-10(2,7-14(3)4)6-13-18(15,16)8-5-12-9(11)17-8/h5,13H,6-7H2,1-4H3 |
| InChIKey | SOBDVPQSQXDIQH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide?
The IUPAC name of 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide (CID 43455856) is 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide?
The canonical SMILES for 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide is CN(C)CC(C)(C)CNS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide?
The InChIKey is SOBDVPQSQXDIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18ClN3O2S2/c1-10(2,7-14(3)4)6-13-18(15,16)8-5-12-9(11)17-8/h5,13H,6-7H2,1-4H3.
What are the key properties of 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide?
2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide has a molecular weight of 311.86 g/mol, XLogP of 1.66, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-[3-(dimethylamino)-2,2-dimethylpropyl]-1,3-thiazole-5-sulfonamide is sourced from PubChem (CID 43455856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).