About 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide
2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide (PubChem CID 43455968) has the molecular formula C7H10ClN3O3S2
and a molecular weight of 283.76 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide |
| PubChem CID | 43455968 |
| Molecular Formula | C7H10ClN3O3S2 |
| Molecular Weight | 283.76 g/mol |
| Exact Mass | 282.99 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)CNS(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C7H10ClN3O3S2/c1-11(2)5(12)3-10-16(13,14)6-4-9-7(8)15-6/h4,10H,3H2,1-2H3 |
| InChIKey | NEKCSIJOUPJSGF-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.76 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide (CID 43455968) is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide is CN(C)C(=O)CNS(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide?
The InChIKey is NEKCSIJOUPJSGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3O3S2/c1-11(2)5(12)3-10-16(13,14)6-4-9-7(8)15-6/h4,10H,3H2,1-2H3.
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide?
2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide has a molecular weight of 283.76 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonylamino]-N,N-dimethylacetamide is sourced from PubChem (CID 43455968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).