About 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide
2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide (PubChem CID 43455975) has the molecular formula C6H8ClN3O3S2
and a molecular weight of 269.74 g/mol. Its IUPAC name is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide.
Molecular Properties
| Compound Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide |
| PubChem CID | 43455975 |
| Molecular Formula | C6H8ClN3O3S2 |
| Molecular Weight | 269.74 g/mol |
| Exact Mass | 268.97 |
| IUPAC Name | 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide |
| SMILES | CN(CC(N)=O)S(=O)(=O)c1cnc(Cl)s1 |
| InChI | InChI=1S/C6H8ClN3O3S2/c1-10(3-4(8)11)15(12,13)5-2-9-6(7)14-5/h2H,3H2,1H3,(H2,8,11) |
| InChIKey | IRFZLBCGRHGWKA-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.74 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide?
The IUPAC name of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide (CID 43455975) is 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide.
What is the SMILES notation for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide?
The canonical SMILES for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide is CN(CC(N)=O)S(=O)(=O)c1cnc(Cl)s1.
What is the InChIKey of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide?
The InChIKey is IRFZLBCGRHGWKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8ClN3O3S2/c1-10(3-4(8)11)15(12,13)5-2-9-6(7)14-5/h2H,3H2,1H3,(H2,8,11).
What are the key properties of 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide?
2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide has a molecular weight of 269.74 g/mol, XLogP of -0.10, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-chloro-1,3-thiazol-5-yl)sulfonyl-methylamino]acetamide is sourced from PubChem (CID 43455975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).