About 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide
5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide (PubChem CID 43456006) has the molecular formula C6H7ClF3N3O2S
and a molecular weight of 277.66 g/mol. Its IUPAC name is 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide.
Molecular Properties
| Compound Name | 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide |
| PubChem CID | 43456006 |
| Molecular Formula | C6H7ClF3N3O2S |
| Molecular Weight | 277.66 g/mol |
| Exact Mass | 276.99 |
| IUPAC Name | 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NCC(F)(F)F)c1Cl |
| InChI | InChI=1S/C6H7ClF3N3O2S/c1-13-3-11-5(4(13)7)16(14,15)12-2-6(8,9)10/h3,12H,2H2,1H3 |
| InChIKey | PDDNJPHMFLBNGX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.66 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide?
The IUPAC name of 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide (CID 43456006) is 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide.
What is the SMILES notation for 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide?
The canonical SMILES for 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide is Cn1cnc(S(=O)(=O)NCC(F)(F)F)c1Cl.
What is the InChIKey of 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide?
The InChIKey is PDDNJPHMFLBNGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClF3N3O2S/c1-13-3-11-5(4(13)7)16(14,15)12-2-6(8,9)10/h3,12H,2H2,1H3.
What are the key properties of 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide?
5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide has a molecular weight of 277.66 g/mol, XLogP of 0.91, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1-methyl-N-(2,2,2-trifluoroethyl)imidazole-4-sulfonamide is sourced from PubChem (CID 43456006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).