About methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate
methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate (PubChem CID 43456083) has the molecular formula C7H9ClN2O4S2
and a molecular weight of 284.75 g/mol. Its IUPAC name is methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate.
Molecular Properties
| Compound Name | methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate |
| PubChem CID | 43456083 |
| Molecular Formula | C7H9ClN2O4S2 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 283.97 |
| IUPAC Name | methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate |
| SMILES | COC(=O)CNS(=O)(=O)c1sc(Cl)nc1C |
| InChI | InChI=1S/C7H9ClN2O4S2/c1-4-6(15-7(8)10-4)16(12,13)9-3-5(11)14-2/h9H,3H2,1-2H3 |
| InChIKey | JDGBFQNCLNCVMC-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate?
The IUPAC name of methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate (CID 43456083) is methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate.
What is the SMILES notation for methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate?
The canonical SMILES for methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate is COC(=O)CNS(=O)(=O)c1sc(Cl)nc1C.
What is the InChIKey of methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate?
The InChIKey is JDGBFQNCLNCVMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9ClN2O4S2/c1-4-6(15-7(8)10-4)16(12,13)9-3-5(11)14-2/h9H,3H2,1-2H3.
What are the key properties of methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate?
methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate has a molecular weight of 284.75 g/mol, XLogP of 0.56, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[(2-chloro-4-methyl-1,3-thiazol-5-yl)sulfonylamino]acetate is sourced from PubChem (CID 43456083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).