C18H22N2O — CID 43458688
N-[(4-aminophenyl)methyl]-N-ethyl-2,5-dimethylbenzamide (PubChem CID 43458688) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-[(4-aminophenyl)methyl]-N-ethyl-2,5-dimethylbenzamide.
| Compound Name | N-[(4-aminophenyl)methyl]-N-ethyl-2,5-dimethylbenzamide |
|---|---|
| PubChem CID | 43458688 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-[(4-aminophenyl)methyl]-N-ethyl-2,5-dimethylbenzamide |
| SMILES | CCN(Cc1ccc(N)cc1)C(=O)c1cc(C)ccc1C |
| InChI | InChI=1S/C18H22N2O/c1-4-20(12-15-7-9-16(19)10-8-15)18(21)17-11-13(2)5-6-14(17)3/h5-11H,4,12,19H2,1-3H3 |
| InChIKey | XVTCJWCSYQWKLL-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|