C16H27N3O — CID 43459417
2-[(2-aminophenyl)methyl-ethylamino]-N,N-diethylpropanamide (PubChem CID 43459417) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 2-[(2-aminophenyl)methyl-ethylamino]-N,N-diethylpropanamide.
| Compound Name | 2-[(2-aminophenyl)methyl-ethylamino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 43459417 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 2-[(2-aminophenyl)methyl-ethylamino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(CC)Cc1ccccc1N |
| InChI | InChI=1S/C16H27N3O/c1-5-18(6-2)16(20)13(4)19(7-3)12-14-10-8-9-11-15(14)17/h8-11,13H,5-7,12,17H2,1-4H3 |
| InChIKey | GJRUVODOVZKYSK-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|