C14H20N4O2 — CID 43461892
[4-(6-amino-3-pyridinyl)piperazin-1-yl]-(oxolan-2-yl)methanone (PubChem CID 43461892) has the molecular formula C14H20N4O2 and a molecular weight of 276.34 g/mol. Its IUPAC name is [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(oxolan-2-yl)methanone.
| Compound Name | [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
|---|---|
| PubChem CID | 43461892 |
| Molecular Formula | C14H20N4O2 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | [4-(6-amino-3-pyridinyl)piperazin-1-yl]-(oxolan-2-yl)methanone |
| SMILES | Nc1ccc(N2CCN(C(=O)C3CCCO3)CC2)cn1 |
| InChI | InChI=1S/C14H20N4O2/c15-13-4-3-11(10-16-13)17-5-7-18(8-6-17)14(19)12-2-1-9-20-12/h3-4,10,12H,1-2,5-9H2,(H2,15,16) |
| InChIKey | LSZLHWNHMDWXGW-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |