About (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine
(5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine (PubChem CID 43464170) has the molecular formula C11H8BrF2NO
and a molecular weight of 288.09 g/mol. Its IUPAC name is (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine.
Molecular Properties
| Compound Name | (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine |
| PubChem CID | 43464170 |
| Molecular Formula | C11H8BrF2NO |
| Molecular Weight | 288.09 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine |
| SMILES | NC(c1ccc(F)c(F)c1)c1ccc(Br)o1 |
| InChI | InChI=1S/C11H8BrF2NO/c12-10-4-3-9(16-10)11(15)6-1-2-7(13)8(14)5-6/h1-5,11H,15H2 |
| InChIKey | VOCBCZLKQVSSGZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.09 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine?
The IUPAC name of (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine (CID 43464170) is (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine.
What is the SMILES notation for (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine?
The canonical SMILES for (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine is NC(c1ccc(F)c(F)c1)c1ccc(Br)o1.
What is the InChIKey of (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine?
The InChIKey is VOCBCZLKQVSSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrF2NO/c12-10-4-3-9(16-10)11(15)6-1-2-7(13)8(14)5-6/h1-5,11H,15H2.
What are the key properties of (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine?
(5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine has a molecular weight of 288.09 g/mol, XLogP of 3.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5-bromofuran-2-yl)-(3,4-difluorophenyl)methanamine is sourced from PubChem (CID 43464170), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).