About 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one
5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one (PubChem CID 43464497) has the molecular formula C17H18N2OS
and a molecular weight of 298.41 g/mol. Its IUPAC name is 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one.
Molecular Properties
| Compound Name | 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one |
| PubChem CID | 43464497 |
| Molecular Formula | C17H18N2OS |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one |
| SMILES | CN1C(=O)Cc2cc(C(N)c3cc4c(s3)CCC4)ccc21 |
| InChI | InChI=1S/C17H18N2OS/c1-19-13-6-5-11(7-12(13)9-16(19)20)17(18)15-8-10-3-2-4-14(10)21-15/h5-8,17H,2-4,9,18H2,1H3 |
| InChIKey | YWQZBHNDVPUQAV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one?
The IUPAC name of 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one (CID 43464497) is 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one.
What is the SMILES notation for 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one?
The canonical SMILES for 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one is CN1C(=O)Cc2cc(C(N)c3cc4c(s3)CCC4)ccc21.
What is the InChIKey of 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one?
The InChIKey is YWQZBHNDVPUQAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2OS/c1-19-13-6-5-11(7-12(13)9-16(19)20)17(18)15-8-10-3-2-4-14(10)21-15/h5-8,17H,2-4,9,18H2,1H3.
What are the key properties of 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one?
5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one has a molecular weight of 298.41 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[amino(5,6-dihydro-4H-cyclopenta[b]thiophen-2-yl)methyl]-1-methyl-3H-indol-2-one is sourced from PubChem (CID 43464497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).