2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid

C10H12N2O2S — CID 43464889

IUPAC2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid
SMILESCCc1nc2scc(CC(=O)O)n2c1C
InChIInChI=1S/C10H12N2O2S/c1-3-8-6(2)12-7(4-9(13)14)5-15-10(12)11-8/h5H,3-4H2,1-2H3,(H,13,14)
InChIKeyJKPHGHCKNDIVSJ-UHFFFAOYSA-N
MW224.28 g/mol
LogP1.89
Rot. Bonds3

About 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid

2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid (PubChem CID 43464889) has the molecular formula C10H12N2O2S and a molecular weight of 224.28 g/mol. Its IUPAC name is 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid.

Molecular Properties

Compound Name2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid
PubChem CID43464889
Molecular FormulaC10H12N2O2S
Molecular Weight224.28 g/mol
Exact Mass224.06
IUPAC Name2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid
SMILESCCc1nc2scc(CC(=O)O)n2c1C
InChIInChI=1S/C10H12N2O2S/c1-3-8-6(2)12-7(4-9(13)14)5-15-10(12)11-8/h5H,3-4H2,1-2H3,(H,13,14)
InChIKeyJKPHGHCKNDIVSJ-UHFFFAOYSA-N
XLogP1.89
TPSA54.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms15
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500224.28
LogP ≤ 51.89
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid?
The IUPAC name of 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid (CID 43464889) is 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid.
What is the SMILES notation for 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid?
The canonical SMILES for 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid is CCc1nc2scc(CC(=O)O)n2c1C.
What is the InChIKey of 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid?
The InChIKey is JKPHGHCKNDIVSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S/c1-3-8-6(2)12-7(4-9(13)14)5-15-10(12)11-8/h5H,3-4H2,1-2H3,(H,13,14).
What are the key properties of 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid?
2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid has a molecular weight of 224.28 g/mol, XLogP of 1.89, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-ethyl-5-methylimidazo[2,1-b][1,3]thiazol-3-yl)acetic acid is sourced from PubChem (CID 43464889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).