About 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid
2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid (PubChem CID 43465478) has the molecular formula C10H15N3O5S
and a molecular weight of 289.31 g/mol. Its IUPAC name is 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid |
| PubChem CID | 43465478 |
| Molecular Formula | C10H15N3O5S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid |
| SMILES | O=C(O)CNC(=O)CNC(=O)CCN1CCSC1=O |
| InChI | InChI=1S/C10H15N3O5S/c14-7(1-2-13-3-4-19-10(13)18)11-5-8(15)12-6-9(16)17/h1-6H2,(H,11,14)(H,12,15)(H,16,17) |
| InChIKey | SPEBGGYHPHMMGJ-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid?
The IUPAC name of 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid (CID 43465478) is 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid.
What is the SMILES notation for 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid?
The canonical SMILES for 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid is O=C(O)CNC(=O)CNC(=O)CCN1CCSC1=O.
What is the InChIKey of 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid?
The InChIKey is SPEBGGYHPHMMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O5S/c14-7(1-2-13-3-4-19-10(13)18)11-5-8(15)12-6-9(16)17/h1-6H2,(H,11,14)(H,12,15)(H,16,17).
What are the key properties of 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid?
2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid has a molecular weight of 289.31 g/mol, XLogP of -1.14, 7 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[2-[3-(2-oxo-1,3-thiazolidin-3-yl)propanoylamino]acetyl]amino]acetic acid is sourced from PubChem (CID 43465478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).