About 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid (PubChem CID 43466223) has the molecular formula C6H9N3O3
and a molecular weight of 171.16 g/mol. Its IUPAC name is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid.
Molecular Properties
| Compound Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid |
| PubChem CID | 43466223 |
| Molecular Formula | C6H9N3O3 |
| Molecular Weight | 171.16 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid |
| SMILES | Cc1nc(CNCC(=O)O)no1 |
| InChI | InChI=1S/C6H9N3O3/c1-4-8-5(9-12-4)2-7-3-6(10)11/h7H,2-3H2,1H3,(H,10,11) |
| InChIKey | LIBGUTNLVSKXAC-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 88.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.16 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid?
The IUPAC name of 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid (CID 43466223) is 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid.
What is the SMILES notation for 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid?
The canonical SMILES for 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid is Cc1nc(CNCC(=O)O)no1.
What is the InChIKey of 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid?
The InChIKey is LIBGUTNLVSKXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O3/c1-4-8-5(9-12-4)2-7-3-6(10)11/h7H,2-3H2,1H3,(H,10,11).
What are the key properties of 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid?
2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid has a molecular weight of 171.16 g/mol, XLogP of -0.45, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-methyl-1,2,4-oxadiazol-3-yl)methylamino]acetic acid is sourced from PubChem (CID 43466223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).