About 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid
3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid (PubChem CID 43466330) has the molecular formula C10H17N3O4
and a molecular weight of 243.26 g/mol. Its IUPAC name is 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid.
Molecular Properties
| Compound Name | 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid |
| PubChem CID | 43466330 |
| Molecular Formula | C10H17N3O4 |
| Molecular Weight | 243.26 g/mol |
| Exact Mass | 243.12 |
| IUPAC Name | 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid |
| SMILES | CC1(C)NC(=O)N(CCNCCC(=O)O)C1=O |
| InChI | InChI=1S/C10H17N3O4/c1-10(2)8(16)13(9(17)12-10)6-5-11-4-3-7(14)15/h11H,3-6H2,1-2H3,(H,12,17)(H,14,15) |
| InChIKey | DSXOEXVXVTTXGA-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid?
The IUPAC name of 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid (CID 43466330) is 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid.
What is the SMILES notation for 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid?
The canonical SMILES for 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid is CC1(C)NC(=O)N(CCNCCC(=O)O)C1=O.
What is the InChIKey of 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid?
The InChIKey is DSXOEXVXVTTXGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O4/c1-10(2)8(16)13(9(17)12-10)6-5-11-4-3-7(14)15/h11H,3-6H2,1-2H3,(H,12,17)(H,14,15).
What are the key properties of 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid?
3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid has a molecular weight of 243.26 g/mol, XLogP of -0.62, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethylamino]propanoic acid is sourced from PubChem (CID 43466330), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).