C10H16N4O3S2 — CID 43466521
3-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]propanoic acid (PubChem CID 43466521) has the molecular formula C10H16N4O3S2 and a molecular weight of 304.40 g/mol. Its IUPAC name is 3-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]propanoic acid.
| Compound Name | 3-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466521 |
| Molecular Formula | C10H16N4O3S2 |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 3-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]propanoic acid |
| SMILES | CCCSc1nsc(NC(=O)CNCCC(=O)O)n1 |
| InChI | InChI=1S/C10H16N4O3S2/c1-2-5-18-10-13-9(19-14-10)12-7(15)6-11-4-3-8(16)17/h11H,2-6H2,1H3,(H,16,17)(H,12,13,14,15) |
| InChIKey | FNIKKNZHKNIMTE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|