3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid

C8H13N3O3 — CID 43466750

IUPAC3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid
SMILESCCc1noc(CNCCC(=O)O)n1
InChIInChI=1S/C8H13N3O3/c1-2-6-10-7(14-11-6)5-9-4-3-8(12)13/h9H,2-5H2,1H3,(H,12,13)
InChIKeyZZHRCTNMKQJJNN-UHFFFAOYSA-N
MW199.21 g/mol
LogP0.20
Rot. Bonds6

About 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid

3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid (PubChem CID 43466750) has the molecular formula C8H13N3O3 and a molecular weight of 199.21 g/mol. Its IUPAC name is 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid.

Molecular Properties

Compound Name3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid
PubChem CID43466750
Molecular FormulaC8H13N3O3
Molecular Weight199.21 g/mol
Exact Mass199.10
IUPAC Name3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid
SMILESCCc1noc(CNCCC(=O)O)n1
InChIInChI=1S/C8H13N3O3/c1-2-6-10-7(14-11-6)5-9-4-3-8(12)13/h9H,2-5H2,1H3,(H,12,13)
InChIKeyZZHRCTNMKQJJNN-UHFFFAOYSA-N
XLogP0.20
TPSA88.25 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.21
LogP ≤ 50.20
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid?
The IUPAC name of 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid (CID 43466750) is 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid.
What is the SMILES notation for 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid?
The canonical SMILES for 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid is CCc1noc(CNCCC(=O)O)n1.
What is the InChIKey of 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid?
The InChIKey is ZZHRCTNMKQJJNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13N3O3/c1-2-6-10-7(14-11-6)5-9-4-3-8(12)13/h9H,2-5H2,1H3,(H,12,13).
What are the key properties of 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid?
3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid has a molecular weight of 199.21 g/mol, XLogP of 0.20, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-ethyl-1,2,4-oxadiazol-5-yl)methylamino]propanoic acid is sourced from PubChem (CID 43466750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).