3-(1,2-oxazol-5-ylmethylamino)propanoic acid

C7H10N2O3 — CID 43466757

IUPAC3-(1,2-oxazol-5-ylmethylamino)propanoic acid
SMILESO=C(O)CCNCc1ccno1
InChIInChI=1S/C7H10N2O3/c10-7(11)2-3-8-5-6-1-4-9-12-6/h1,4,8H,2-3,5H2,(H,10,11)
InChIKeyBNRQVNGEUANQKI-UHFFFAOYSA-N
MW170.17 g/mol
LogP0.24
Rot. Bonds5

About 3-(1,2-oxazol-5-ylmethylamino)propanoic acid

3-(1,2-oxazol-5-ylmethylamino)propanoic acid (PubChem CID 43466757) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-(1,2-oxazol-5-ylmethylamino)propanoic acid.

Molecular Properties

Compound Name3-(1,2-oxazol-5-ylmethylamino)propanoic acid
PubChem CID43466757
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Name3-(1,2-oxazol-5-ylmethylamino)propanoic acid
SMILESO=C(O)CCNCc1ccno1
InChIInChI=1S/C7H10N2O3/c10-7(11)2-3-8-5-6-1-4-9-12-6/h1,4,8H,2-3,5H2,(H,10,11)
InChIKeyBNRQVNGEUANQKI-UHFFFAOYSA-N
XLogP0.24
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 50.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(1,2-oxazol-5-ylmethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(1,2-oxazol-5-ylmethylamino)propanoic acid?
The IUPAC name of 3-(1,2-oxazol-5-ylmethylamino)propanoic acid (CID 43466757) is 3-(1,2-oxazol-5-ylmethylamino)propanoic acid.
What is the SMILES notation for 3-(1,2-oxazol-5-ylmethylamino)propanoic acid?
The canonical SMILES for 3-(1,2-oxazol-5-ylmethylamino)propanoic acid is O=C(O)CCNCc1ccno1.
What is the InChIKey of 3-(1,2-oxazol-5-ylmethylamino)propanoic acid?
The InChIKey is BNRQVNGEUANQKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c10-7(11)2-3-8-5-6-1-4-9-12-6/h1,4,8H,2-3,5H2,(H,10,11).
What are the key properties of 3-(1,2-oxazol-5-ylmethylamino)propanoic acid?
3-(1,2-oxazol-5-ylmethylamino)propanoic acid has a molecular weight of 170.17 g/mol, XLogP of 0.24, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-oxazol-5-ylmethylamino)propanoic acid is sourced from PubChem (CID 43466757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).