C7H10N2O3 — CID 43466757
3-(1,2-oxazol-5-ylmethylamino)propanoic acid (PubChem CID 43466757) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 3-(1,2-oxazol-5-ylmethylamino)propanoic acid.
| Compound Name | 3-(1,2-oxazol-5-ylmethylamino)propanoic acid |
|---|---|
| PubChem CID | 43466757 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 3-(1,2-oxazol-5-ylmethylamino)propanoic acid |
| SMILES | O=C(O)CCNCc1ccno1 |
| InChI | InChI=1S/C7H10N2O3/c10-7(11)2-3-8-5-6-1-4-9-12-6/h1,4,8H,2-3,5H2,(H,10,11) |
| InChIKey | BNRQVNGEUANQKI-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|