C11H12BrClN2O3 — CID 43466879
2-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]amino]propanoic acid (PubChem CID 43466879) has the molecular formula C11H12BrClN2O3 and a molecular weight of 335.59 g/mol. Its IUPAC name is 2-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]amino]propanoic acid.
| Compound Name | 2-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]amino]propanoic acid |
|---|---|
| PubChem CID | 43466879 |
| Molecular Formula | C11H12BrClN2O3 |
| Molecular Weight | 335.59 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | 2-[[2-(4-bromo-2-chloroanilino)-2-oxoethyl]amino]propanoic acid |
| SMILES | CC(NCC(=O)Nc1ccc(Br)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12BrClN2O3/c1-6(11(17)18)14-5-10(16)15-9-3-2-7(12)4-8(9)13/h2-4,6,14H,5H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ZACRTTVLFGTUJM-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.59 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |