2-(1,2-oxazol-5-ylmethylamino)propanoic acid

C7H10N2O3 — CID 43467356

IUPAC2-(1,2-oxazol-5-ylmethylamino)propanoic acid
SMILESCC(NCc1ccno1)C(=O)O
InChIInChI=1S/C7H10N2O3/c1-5(7(10)11)8-4-6-2-3-9-12-6/h2-3,5,8H,4H2,1H3,(H,10,11)
InChIKeyHEEJFJRHHJWCMR-UHFFFAOYSA-N
MW170.17 g/mol
LogP0.24
Rot. Bonds4

About 2-(1,2-oxazol-5-ylmethylamino)propanoic acid

2-(1,2-oxazol-5-ylmethylamino)propanoic acid (PubChem CID 43467356) has the molecular formula C7H10N2O3 and a molecular weight of 170.17 g/mol. Its IUPAC name is 2-(1,2-oxazol-5-ylmethylamino)propanoic acid.

Molecular Properties

Compound Name2-(1,2-oxazol-5-ylmethylamino)propanoic acid
PubChem CID43467356
Molecular FormulaC7H10N2O3
Molecular Weight170.17 g/mol
Exact Mass170.07
IUPAC Name2-(1,2-oxazol-5-ylmethylamino)propanoic acid
SMILESCC(NCc1ccno1)C(=O)O
InChIInChI=1S/C7H10N2O3/c1-5(7(10)11)8-4-6-2-3-9-12-6/h2-3,5,8H,4H2,1H3,(H,10,11)
InChIKeyHEEJFJRHHJWCMR-UHFFFAOYSA-N
XLogP0.24
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500170.17
LogP ≤ 50.24
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(1,2-oxazol-5-ylmethylamino)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,2-oxazol-5-ylmethylamino)propanoic acid?
The IUPAC name of 2-(1,2-oxazol-5-ylmethylamino)propanoic acid (CID 43467356) is 2-(1,2-oxazol-5-ylmethylamino)propanoic acid.
What is the SMILES notation for 2-(1,2-oxazol-5-ylmethylamino)propanoic acid?
The canonical SMILES for 2-(1,2-oxazol-5-ylmethylamino)propanoic acid is CC(NCc1ccno1)C(=O)O.
What is the InChIKey of 2-(1,2-oxazol-5-ylmethylamino)propanoic acid?
The InChIKey is HEEJFJRHHJWCMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5(7(10)11)8-4-6-2-3-9-12-6/h2-3,5,8H,4H2,1H3,(H,10,11).
What are the key properties of 2-(1,2-oxazol-5-ylmethylamino)propanoic acid?
2-(1,2-oxazol-5-ylmethylamino)propanoic acid has a molecular weight of 170.17 g/mol, XLogP of 0.24, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,2-oxazol-5-ylmethylamino)propanoic acid is sourced from PubChem (CID 43467356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).