C11H18F3NO4 — CID 43467491
3,3-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid (PubChem CID 43467491) has the molecular formula C11H18F3NO4 and a molecular weight of 285.26 g/mol. Its IUPAC name is 3,3-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid.
| Compound Name | 3,3-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid |
|---|---|
| PubChem CID | 43467491 |
| Molecular Formula | C11H18F3NO4 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | 3,3-dimethyl-2-[3-(2,2,2-trifluoroethoxy)propanoylamino]butanoic acid |
| SMILES | CC(C)(C)C(NC(=O)CCOCC(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H18F3NO4/c1-10(2,3)8(9(17)18)15-7(16)4-5-19-6-11(12,13)14/h8H,4-6H2,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | KYENQQIAOCOQRD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|