3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid

C11H18N4O3 — CID 43467798

IUPAC3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid
SMILESCC(C)(C)C(NC(=O)CCn1ccnn1)C(=O)O
InChIInChI=1S/C11H18N4O3/c1-11(2,3)9(10(17)18)13-8(16)4-6-15-7-5-12-14-15/h5,7,9H,4,6H2,1-3H3,(H,13,16)(H,17,18)
InChIKeyQQBLGCOMGYTIFR-UHFFFAOYSA-N
MW254.29 g/mol
LogP0.28
Rot. Bonds5

About 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid

3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid (PubChem CID 43467798) has the molecular formula C11H18N4O3 and a molecular weight of 254.29 g/mol. Its IUPAC name is 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid.

Molecular Properties

Compound Name3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid
PubChem CID43467798
Molecular FormulaC11H18N4O3
Molecular Weight254.29 g/mol
Exact Mass254.14
IUPAC Name3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid
SMILESCC(C)(C)C(NC(=O)CCn1ccnn1)C(=O)O
InChIInChI=1S/C11H18N4O3/c1-11(2,3)9(10(17)18)13-8(16)4-6-15-7-5-12-14-15/h5,7,9H,4,6H2,1-3H3,(H,13,16)(H,17,18)
InChIKeyQQBLGCOMGYTIFR-UHFFFAOYSA-N
XLogP0.28
TPSA97.11 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 50.28
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
The IUPAC name of 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid (CID 43467798) is 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid.
What is the SMILES notation for 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
The canonical SMILES for 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid is CC(C)(C)C(NC(=O)CCn1ccnn1)C(=O)O.
What is the InChIKey of 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
The InChIKey is QQBLGCOMGYTIFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4O3/c1-11(2,3)9(10(17)18)13-8(16)4-6-15-7-5-12-14-15/h5,7,9H,4,6H2,1-3H3,(H,13,16)(H,17,18).
What are the key properties of 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid?
3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid has a molecular weight of 254.29 g/mol, XLogP of 0.28, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyl-2-[3-(triazol-1-yl)propanoylamino]butanoic acid is sourced from PubChem (CID 43467798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).