C18H21NO2 — CID 43468629
3-methyl-2-[(4-phenylphenyl)methylamino]butanoic acid (PubChem CID 43468629) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-methyl-2-[(4-phenylphenyl)methylamino]butanoic acid.
| Compound Name | 3-methyl-2-[(4-phenylphenyl)methylamino]butanoic acid |
|---|---|
| PubChem CID | 43468629 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 3-methyl-2-[(4-phenylphenyl)methylamino]butanoic acid |
| SMILES | CC(C)C(NCc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C18H21NO2/c1-13(2)17(18(20)21)19-12-14-8-10-16(11-9-14)15-6-4-3-5-7-15/h3-11,13,17,19H,12H2,1-2H3,(H,20,21) |
| InChIKey | DUTGFYLOPDJXHO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |