C13H18N2O5 — CID 43468781
2-[(2-methoxy-5-nitrophenyl)methylamino]-3-methylbutanoic acid (PubChem CID 43468781) has the molecular formula C13H18N2O5 and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(2-methoxy-5-nitrophenyl)methylamino]-3-methylbutanoic acid.
| Compound Name | 2-[(2-methoxy-5-nitrophenyl)methylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 43468781 |
| Molecular Formula | C13H18N2O5 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 2-[(2-methoxy-5-nitrophenyl)methylamino]-3-methylbutanoic acid |
| SMILES | COc1ccc([N+](=O)[O-])cc1CNC(C(=O)O)C(C)C |
| InChI | InChI=1S/C13H18N2O5/c1-8(2)12(13(16)17)14-7-9-6-10(15(18)19)4-5-11(9)20-3/h4-6,8,12,14H,7H2,1-3H3,(H,16,17) |
| InChIKey | UXCLTROMANSSJI-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|