C10H13N3O5 — CID 43469527
2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid (PubChem CID 43469527) has the molecular formula C10H13N3O5 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid.
| Compound Name | 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43469527 |
| Molecular Formula | C10H13N3O5 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.09 |
| IUPAC Name | 2-[[2-(2,4-dioxo-1H-pyrimidin-6-yl)acetyl]amino]butanoic acid |
| SMILES | CCC(NC(=O)Cc1cc(=O)[nH]c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C10H13N3O5/c1-2-6(9(16)17)12-7(14)3-5-4-8(15)13-10(18)11-5/h4,6H,2-3H2,1H3,(H,12,14)(H,16,17)(H2,11,13,15,18) |
| InChIKey | IQWVYTSGGVLMGD-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 132.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |