C14H23NO4 — CID 43470103
2-(3-methyl-2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoic acid (PubChem CID 43470103) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-(3-methyl-2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoic acid.
| Compound Name | 2-(3-methyl-2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoic acid |
|---|---|
| PubChem CID | 43470103 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 2-(3-methyl-2,5-dioxo-3-propan-2-ylpyrrolidin-1-yl)hexanoic acid |
| SMILES | CCCCC(C(=O)O)N1C(=O)CC(C)(C(C)C)C1=O |
| InChI | InChI=1S/C14H23NO4/c1-5-6-7-10(12(17)18)15-11(16)8-14(4,9(2)3)13(15)19/h9-10H,5-8H2,1-4H3,(H,17,18) |
| InChIKey | GOCLIWDZWPEFEK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|