C11H12BrN3OS — CID 43470774
N-(2,1,3-benzothiadiazol-4-yl)-2-bromo-3-methylbutanamide (PubChem CID 43470774) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is N-(2,1,3-benzothiadiazol-4-yl)-2-bromo-3-methylbutanamide.
| Compound Name | N-(2,1,3-benzothiadiazol-4-yl)-2-bromo-3-methylbutanamide |
|---|---|
| PubChem CID | 43470774 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-(2,1,3-benzothiadiazol-4-yl)-2-bromo-3-methylbutanamide |
| SMILES | CC(C)C(Br)C(=O)Nc1cccc2nsnc12 |
| InChI | InChI=1S/C11H12BrN3OS/c1-6(2)9(12)11(16)13-7-4-3-5-8-10(7)15-17-14-8/h3-6,9H,1-2H3,(H,13,16) |
| InChIKey | BNFFNRSDMWAJJZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|