1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid

C16H19NO2S — CID 43470940

IUPAC1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid
SMILESO=C(O)C1(Cc2nc3ccccc3s2)CCCCCC1
InChIInChI=1S/C16H19NO2S/c18-15(19)16(9-5-1-2-6-10-16)11-14-17-12-7-3-4-8-13(12)20-14/h3-4,7-8H,1-2,5-6,9-11H2,(H,18,19)
InChIKeyOXNXUIGQUVSSRF-UHFFFAOYSA-N
MW289.40 g/mol
LogP4.26
Rot. Bonds3

About 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid

1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid (PubChem CID 43470940) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid.

Molecular Properties

Compound Name1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid
PubChem CID43470940
Molecular FormulaC16H19NO2S
Molecular Weight289.40 g/mol
Exact Mass289.11
IUPAC Name1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid
SMILESO=C(O)C1(Cc2nc3ccccc3s2)CCCCCC1
InChIInChI=1S/C16H19NO2S/c18-15(19)16(9-5-1-2-6-10-16)11-14-17-12-7-3-4-8-13(12)20-14/h3-4,7-8H,1-2,5-6,9-11H2,(H,18,19)
InChIKeyOXNXUIGQUVSSRF-UHFFFAOYSA-N
XLogP4.26
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500289.40
LogP ≤ 54.26
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid?
The IUPAC name of 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid (CID 43470940) is 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid.
What is the SMILES notation for 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid?
The canonical SMILES for 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid is O=C(O)C1(Cc2nc3ccccc3s2)CCCCCC1.
What is the InChIKey of 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid?
The InChIKey is OXNXUIGQUVSSRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2S/c18-15(19)16(9-5-1-2-6-10-16)11-14-17-12-7-3-4-8-13(12)20-14/h3-4,7-8H,1-2,5-6,9-11H2,(H,18,19).
What are the key properties of 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid?
1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid has a molecular weight of 289.40 g/mol, XLogP of 4.26, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid is sourced from PubChem (CID 43470940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).