C16H19NO2S — CID 43470940
1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid (PubChem CID 43470940) has the molecular formula C16H19NO2S and a molecular weight of 289.40 g/mol. Its IUPAC name is 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid.
| Compound Name | 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 43470940 |
| Molecular Formula | C16H19NO2S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | 1-(1,3-benzothiazol-2-ylmethyl)cycloheptane-1-carboxylic acid |
| SMILES | O=C(O)C1(Cc2nc3ccccc3s2)CCCCCC1 |
| InChI | InChI=1S/C16H19NO2S/c18-15(19)16(9-5-1-2-6-10-16)11-14-17-12-7-3-4-8-13(12)20-14/h3-4,7-8H,1-2,5-6,9-11H2,(H,18,19) |
| InChIKey | OXNXUIGQUVSSRF-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |