About 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid
3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid (PubChem CID 43471124) has the molecular formula C9H10N4O4S
and a molecular weight of 270.27 g/mol. Its IUPAC name is 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid.
Molecular Properties
| Compound Name | 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid |
| PubChem CID | 43471124 |
| Molecular Formula | C9H10N4O4S |
| Molecular Weight | 270.27 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid |
| SMILES | CC(CC(=O)O)Nc1nc2sccn2c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10N4O4S/c1-5(4-6(14)15)10-7-8(13(16)17)12-2-3-18-9(12)11-7/h2-3,5,10H,4H2,1H3,(H,14,15) |
| InChIKey | CYZHDNPYVFQHMK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.27 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
The IUPAC name of 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid (CID 43471124) is 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid.
What is the SMILES notation for 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
The canonical SMILES for 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid is CC(CC(=O)O)Nc1nc2sccn2c1[N+](=O)[O-].
What is the InChIKey of 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
The InChIKey is CYZHDNPYVFQHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O4S/c1-5(4-6(14)15)10-7-8(13(16)17)12-2-3-18-9(12)11-7/h2-3,5,10H,4H2,1H3,(H,14,15).
What are the key properties of 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid?
3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid has a molecular weight of 270.27 g/mol, XLogP of 1.58, 5 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5-nitroimidazo[2,1-b][1,3]thiazol-6-yl)amino]butanoic acid is sourced from PubChem (CID 43471124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).