C11H11N3O5 — CID 43472935
[2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-nitrophenyl]methanol (PubChem CID 43472935) has the molecular formula C11H11N3O5 and a molecular weight of 265.23 g/mol. Its IUPAC name is [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-nitrophenyl]methanol.
| Compound Name | [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-nitrophenyl]methanol |
|---|---|
| PubChem CID | 43472935 |
| Molecular Formula | C11H11N3O5 |
| Molecular Weight | 265.23 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | [2-[(5-methyl-1,2,4-oxadiazol-3-yl)methoxy]-5-nitrophenyl]methanol |
| SMILES | Cc1nc(COc2ccc([N+](=O)[O-])cc2CO)no1 |
| InChI | InChI=1S/C11H11N3O5/c1-7-12-11(13-19-7)6-18-10-3-2-9(14(16)17)4-8(10)5-15/h2-4,15H,5-6H2,1H3 |
| InChIKey | HITSUXSQKNPSAM-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.23 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|