C11H18N4O3S2 — CID 43473619
4-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]butanoic acid (PubChem CID 43473619) has the molecular formula C11H18N4O3S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is 4-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]butanoic acid.
| Compound Name | 4-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]butanoic acid |
|---|---|
| PubChem CID | 43473619 |
| Molecular Formula | C11H18N4O3S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 4-[[2-oxo-2-[(3-propylsulfanyl-1,2,4-thiadiazol-5-yl)amino]ethyl]amino]butanoic acid |
| SMILES | CCCSc1nsc(NC(=O)CNCCCC(=O)O)n1 |
| InChI | InChI=1S/C11H18N4O3S2/c1-2-6-19-11-14-10(20-15-11)13-8(16)7-12-5-3-4-9(17)18/h12H,2-7H2,1H3,(H,17,18)(H,13,14,15,16) |
| InChIKey | HCXPBHKJMAGZHL-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 104.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|