About 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid
4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid (PubChem CID 43473726) has the molecular formula C12H22N2O5S
and a molecular weight of 306.38 g/mol. Its IUPAC name is 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid.
Molecular Properties
| Compound Name | 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid |
| PubChem CID | 43473726 |
| Molecular Formula | C12H22N2O5S |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid |
| SMILES | CCN(C(=O)CNCCCC(=O)O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N2O5S/c1-2-14(10-5-7-20(18,19)9-10)11(15)8-13-6-3-4-12(16)17/h10,13H,2-9H2,1H3,(H,16,17) |
| InChIKey | LYXBQRHMMONGAG-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid?
The IUPAC name of 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid (CID 43473726) is 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid.
What is the SMILES notation for 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid?
The canonical SMILES for 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid is CCN(C(=O)CNCCCC(=O)O)C1CCS(=O)(=O)C1.
What is the InChIKey of 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid?
The InChIKey is LYXBQRHMMONGAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O5S/c1-2-14(10-5-7-20(18,19)9-10)11(15)8-13-6-3-4-12(16)17/h10,13H,2-9H2,1H3,(H,16,17).
What are the key properties of 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid?
4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid has a molecular weight of 306.38 g/mol, XLogP of -0.52, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[2-[(1,1-dioxothiolan-3-yl)-ethylamino]-2-oxoethyl]amino]butanoic acid is sourced from PubChem (CID 43473726), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).