C15H18N4OS — CID 43475571
1-(2-aminophenyl)-N-methyl-N-(thiolan-3-yl)pyrazole-3-carboxamide (PubChem CID 43475571) has the molecular formula C15H18N4OS and a molecular weight of 302.40 g/mol. Its IUPAC name is 1-(2-aminophenyl)-N-methyl-N-(thiolan-3-yl)pyrazole-3-carboxamide.
| Compound Name | 1-(2-aminophenyl)-N-methyl-N-(thiolan-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 43475571 |
| Molecular Formula | C15H18N4OS |
| Molecular Weight | 302.40 g/mol |
| Exact Mass | 302.12 |
| IUPAC Name | 1-(2-aminophenyl)-N-methyl-N-(thiolan-3-yl)pyrazole-3-carboxamide |
| SMILES | CN(C(=O)c1ccn(-c2ccccc2N)n1)C1CCSC1 |
| InChI | InChI=1S/C15H18N4OS/c1-18(11-7-9-21-10-11)15(20)13-6-8-19(17-13)14-5-3-2-4-12(14)16/h2-6,8,11H,7,9-10,16H2,1H3 |
| InChIKey | NFOWNMUTGZKIQS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 64.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|