About N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine
N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine (PubChem CID 43477153) has the molecular formula C10H20N2S
and a molecular weight of 200.35 g/mol. Its IUPAC name is N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
Molecular Properties
| Compound Name | N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| PubChem CID | 43477153 |
| Molecular Formula | C10H20N2S |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine |
| SMILES | CCCCCCNC1=NCC(C)S1 |
| InChI | InChI=1S/C10H20N2S/c1-3-4-5-6-7-11-10-12-8-9(2)13-10/h9H,3-8H2,1-2H3,(H,11,12) |
| InChIKey | VNEJBLFPFYYVTJ-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The IUPAC name of N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine (CID 43477153) is N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine.
What is the SMILES notation for N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The canonical SMILES for N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine is CCCCCCNC1=NCC(C)S1.
What is the InChIKey of N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
The InChIKey is VNEJBLFPFYYVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2S/c1-3-4-5-6-7-11-10-12-8-9(2)13-10/h9H,3-8H2,1-2H3,(H,11,12).
What are the key properties of N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine?
N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine has a molecular weight of 200.35 g/mol, XLogP of 2.65, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-5-methyl-4,5-dihydro-1,3-thiazol-2-amine is sourced from PubChem (CID 43477153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).