C16H19N3O2 — CID 43477879
(E)-3-[2-(3-methylpiperidin-1-yl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid (PubChem CID 43477879) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is (E)-3-[2-(3-methylpiperidin-1-yl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-(3-methylpiperidin-1-yl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43477879 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | (E)-3-[2-(3-methylpiperidin-1-yl)imidazo[1,2-a]pyridin-3-yl]prop-2-enoic acid |
| SMILES | CC1CCCN(c2nc3ccccn3c2/C=C/C(=O)O)C1 |
| InChI | InChI=1S/C16H19N3O2/c1-12-5-4-9-18(11-12)16-13(7-8-15(20)21)19-10-3-2-6-14(19)17-16/h2-3,6-8,10,12H,4-5,9,11H2,1H3,(H,20,21)/b8-7+ |
| InChIKey | XZLDXOBGTJFYMV-BQYQJAHWSA-N |
| XLogP | 2.67 |
| TPSA | 57.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|