C15H15N3O — CID 43478692
[2-(2-methylphenoxy)imidazo[1,2-a]pyridin-3-yl]methanamine (PubChem CID 43478692) has the molecular formula C15H15N3O and a molecular weight of 253.31 g/mol. Its IUPAC name is [2-(2-methylphenoxy)imidazo[1,2-a]pyridin-3-yl]methanamine.
| Compound Name | [2-(2-methylphenoxy)imidazo[1,2-a]pyridin-3-yl]methanamine |
|---|---|
| PubChem CID | 43478692 |
| Molecular Formula | C15H15N3O |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | [2-(2-methylphenoxy)imidazo[1,2-a]pyridin-3-yl]methanamine |
| SMILES | Cc1ccccc1Oc1nc2ccccn2c1CN |
| InChI | InChI=1S/C15H15N3O/c1-11-6-2-3-7-13(11)19-15-12(10-16)18-9-5-4-8-14(18)17-15/h2-9H,10,16H2,1H3 |
| InChIKey | MJRZCLATPYQLNC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |