C9H13N5 — CID 43479039
N-methyl-3-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)propan-1-amine (PubChem CID 43479039) has the molecular formula C9H13N5 and a molecular weight of 191.24 g/mol. Its IUPAC name is N-methyl-3-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)propan-1-amine.
| Compound Name | N-methyl-3-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 43479039 |
| Molecular Formula | C9H13N5 |
| Molecular Weight | 191.24 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | N-methyl-3-([1,2,4]triazolo[4,3-a]pyrazin-3-yl)propan-1-amine |
| SMILES | CNCCCc1nnc2cnccn12 |
| InChI | InChI=1S/C9H13N5/c1-10-4-2-3-8-12-13-9-7-11-5-6-14(8)9/h5-7,10H,2-4H2,1H3 |
| InChIKey | LVKIWHLOSUKMSK-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.24 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|