C13H21NO2 — CID 43481153
1-(3,4-dimethoxyphenyl)-N-methylbutan-1-amine (PubChem CID 43481153) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-N-methylbutan-1-amine.
| Compound Name | 1-(3,4-dimethoxyphenyl)-N-methylbutan-1-amine |
|---|---|
| PubChem CID | 43481153 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-N-methylbutan-1-amine |
| SMILES | CCCC(NC)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H21NO2/c1-5-6-11(14-2)10-7-8-12(15-3)13(9-10)16-4/h7-9,11,14H,5-6H2,1-4H3 |
| InChIKey | AWMAWNJIMQGFBP-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |