C12H11Br2NS — CID 43482198
1-(2,5-dibromophenyl)-N-methyl-1-thiophen-2-ylmethanamine (PubChem CID 43482198) has the molecular formula C12H11Br2NS and a molecular weight of 361.10 g/mol. Its IUPAC name is 1-(2,5-dibromophenyl)-N-methyl-1-thiophen-2-ylmethanamine.
| Compound Name | 1-(2,5-dibromophenyl)-N-methyl-1-thiophen-2-ylmethanamine |
|---|---|
| PubChem CID | 43482198 |
| Molecular Formula | C12H11Br2NS |
| Molecular Weight | 361.10 g/mol |
| Exact Mass | 358.90 |
| IUPAC Name | 1-(2,5-dibromophenyl)-N-methyl-1-thiophen-2-ylmethanamine |
| SMILES | CNC(c1cccs1)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C12H11Br2NS/c1-15-12(11-3-2-6-16-11)9-7-8(13)4-5-10(9)14/h2-7,12,15H,1H3 |
| InChIKey | VUJWPRKUYFVDBU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.10 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |